Difference between revisions of "ORNITHINE-CYCLODEAMINASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_6030 == * left end position: ** 2338 * transcription direction: ** POSITIVE * right end position: ** 4353 * centisome position: ** 15.63879...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-724 CPD-724] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)C...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_6030 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-724 CPD-724] ==
−
* left end position:
+
* smiles:
−
** 2338
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N
−
* right end position:
+
* common name:
−
** 4353
+
** 6α-hydroxy-castasterone
−
* centisome position:
+
* molecular weight:
−
** 15.638796    
+
** 466.7    
 
* Synonym(s):
 
* Synonym(s):
 +
** hydroxydeoxocastasterone
 +
** 6α-hydroxy-6-deoxocastasterone
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.1.3.56-RXN]]
+
* [[RXN-779]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
* [[RXN-778]]
−
* [[RXN-8730]]
+
== Reaction(s) of unknown directionality ==
−
** in-silico_annotation
+
−
***automated-name-match
+
−
== Pathways associated ==
+
−
* [[PWY-6364]]
+
−
* [[PWY-6362]]
+
−
* [[PWY-6363]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2338}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15542699 15542699]
−
{{#set: right end position=4353}}
+
* CHEBI:
−
{{#set: centisome position=15.638796   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20760 20760]
−
{{#set: reaction associated=3.1.3.56-RXN|RXN-8730}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY-6364|PWY-6362|PWY-6363}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15803 C15803]
 +
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N}}
 +
{{#set: common name=6α-hydroxy-castasterone}}
 +
{{#set: molecular weight=466.7   }}
 +
{{#set: common name=hydroxydeoxocastasterone|6α-hydroxy-6-deoxocastasterone}}
 +
{{#set: consumed by=RXN-779}}
 +
{{#set: produced by=RXN-778}}

Revision as of 19:16, 18 March 2018

Metabolite CPD-724

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N
  • common name:
    • 6α-hydroxy-castasterone
  • molecular weight:
    • 466.7
  • Synonym(s):
    • hydroxydeoxocastasterone
    • 6α-hydroxy-6-deoxocastasterone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ORNITHINE-CYCLODEAMINASE-RXN&oldid=23155"