Difference between revisions of "CHD-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-724 CPD-724] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] == |
* smiles: | * smiles: | ||
| − | ** CC(C)C(C) | + | ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N |
* common name: | * common name: | ||
| − | ** 6 | + | ** 6-deoxocathasterone |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 418.702 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** deoxocathasterone |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-774]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-773]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * LIPID_MAPS : LMST01030124 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061344 16061344] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20714 20714] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15798 C15798] |
| − | {{#set: smiles=CC(C)C(C) | + | {{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N}} |
| − | {{#set: common name=6 | + | {{#set: common name=6-deoxocathasterone}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=418.702 }} |
| − | {{#set: common name= | + | {{#set: common name=deoxocathasterone}} |
| − | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-774}} |
| − | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-773}} |
Revision as of 18:17, 18 March 2018
Contents
Metabolite CPD-712
- smiles:
- CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N
- common name:
- 6-deoxocathasterone
- molecular weight:
- 418.702
- Synonym(s):
- deoxocathasterone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
