Difference between revisions of "RXN-14775"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] == * smiles: ** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL GLYCEROL] == * smiles: ** C(C(O)CO)O * inchi key: ** InChIKey=PEDCQBHIVMGVHV-UHFFFAOYS...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL GLYCEROL] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C(O)CO)O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=PEDCQBHIVMGVHV-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** glycerol |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 92.094 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 1,2,3-trihydroxypropane | ||
| + | ** glycerin | ||
| + | ** 1,2,3-trihydroxypropanol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15088]] |
| + | * [[3.1.1.23-RXN]] | ||
| + | * [[RXN-15089]] | ||
| + | * [[RXN-11382]] | ||
| + | * [[RXN-14073]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[GLYCEROL-DEHYDROGENASE-NADP+-RXN]] | ||
| + | * [[ALCD19]] | ||
| + | * [[GLYCEROL-KIN-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 56-81-5 | ||
| + | * METABOLIGHTS : MTBLC17754 | ||
| + | * DRUGBANK : DB04077 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=753 753] |
| − | {{#set: smiles= | + | * HMDB : HMDB00131 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00116 C00116] |
| − | {{#set: molecular weight= | + | * CHEMSPIDER: |
| − | {{#set: produced by=RXN- | + | ** [http://www.chemspider.com/Chemical-Structure.733.html 733] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17754 17754] | ||
| + | * BIGG : glyc | ||
| + | {{#set: smiles=C(C(O)CO)O}} | ||
| + | {{#set: inchi key=InChIKey=PEDCQBHIVMGVHV-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=glycerol}} | ||
| + | {{#set: molecular weight=92.094 }} | ||
| + | {{#set: common name=1,2,3-trihydroxypropane|glycerin|1,2,3-trihydroxypropanol}} | ||
| + | {{#set: produced by=RXN-15088|3.1.1.23-RXN|RXN-15089|RXN-11382|RXN-14073}} | ||
| + | {{#set: reversible reaction associated=GLYCEROL-DEHYDROGENASE-NADP+-RXN|ALCD19|GLYCEROL-KIN-RXN}} | ||
Revision as of 19:18, 18 March 2018
Contents
Metabolite GLYCEROL
- smiles:
- C(C(O)CO)O
- inchi key:
- InChIKey=PEDCQBHIVMGVHV-UHFFFAOYSA-N
- common name:
- glycerol
- molecular weight:
- 92.094
- Synonym(s):
- 1,2,3-trihydroxypropane
- glycerin
- 1,2,3-trihydroxypropanol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 56-81-5
- METABOLIGHTS : MTBLC17754
- DRUGBANK : DB04077
- PUBCHEM:
- HMDB : HMDB00131
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : glyc
