Difference between revisions of "PWY-5805"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON] == * smiles:...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-I9 PWY-I9] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] * comm...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-I9 PWY-I9] ==
* smiles:
+
* taxonomic range:
** CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N
+
 
* common name:
 
* common name:
** 4α-methyl-5α-cholest-7-en-3-one
+
** L-cysteine biosynthesis VI (from L-methionine)
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** reverse transsulfuration
 +
** methionine to cysteine transsulfuration
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''7''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]]
* [[1.1.1.170-RXN]]
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_14191]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_7852]]
 +
*** [[Tiso_gene_3732]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[O-SUCCHOMOSERLYASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3732]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-7605]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
* [[SAM-PWY]]
 +
** 0 associated gene:
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RIBOSYLHOMOCYSTEINASE-RXN RIBOSYLHOMOCYSTEINASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440345 440345]
+
{{#set: common name=L-cysteine biosynthesis VI (from L-methionine)}}
* CHEMSPIDER:
+
{{#set: common name=reverse transsulfuration|methionine to cysteine transsulfuration}}
** [http://www.chemspider.com/Chemical-Structure.389311.html 389311]
+
{{#set: reaction found=5}}
* CHEBI:
+
{{#set: total reaction=7}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16495 16495]
+
{{#set: completion rate=71.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04453 C04453]
+
* HMDB : HMDB11606
+
{{#set: smiles=CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N}}
+
{{#set: common name=4α-methyl-5α-cholest-7-en-3-one}}
+
{{#set: molecular weight=398.671    }}
+
{{#set: consumed or produced by=1.1.1.170-RXN}}
+

Revision as of 18:18, 18 March 2018

Pathway PWY-I9

  • taxonomic range:
  • common name:
    • L-cysteine biosynthesis VI (from L-methionine)
  • Synonym(s):
    • reverse transsulfuration
    • methionine to cysteine transsulfuration

Reaction(s) found

5 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links