Difference between revisions of "PWY66-367"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] == * smiles: ** C[N+]1(C2(CCC1CC(=O)C2)) * inchi key: ** InChIKey=QQXLDOJG...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D13-25-3-oxo-C44-2-ACPs cis-cis-D13-25-3-oxo-C44-2-ACPs] == * common name: ** a cis,cis...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D13-25-3-oxo-C44-2-ACPs cis-cis-D13-25-3-oxo-C44-2-ACPs] ==
* smiles:
+
** C[N+]1(C2(CCC1CC(=O)C2))
+
* inchi key:
+
** InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O
+
 
* common name:
 
* common name:
** tropinone
+
** a cis,cis-delta13,25-3-oxo-C44:2-[acp]
* molecular weight:
+
** 140.205   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1G-203]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[TROPINE-DEHYDROGENASE-RXN]]
 
 
== External links  ==
 
== External links  ==
* NCI:
+
{{#set: common name=a cis,cis-delta13,25-3-oxo-C44:2-[acp]}}
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=118012 118012]
+
{{#set: consumed by=RXN1G-203}}
* CAS : 532-24-1
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=698003 698003]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00783 C00783]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.2789160.html 2789160]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57851 57851]
+
{{#set: smiles=C[N+]1(C2(CCC1CC(=O)C2))}}
+
{{#set: inchi key=InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O}}
+
{{#set: common name=tropinone}}
+
{{#set: molecular weight=140.205    }}
+
{{#set: consumed or produced by=TROPINE-DEHYDROGENASE-RXN}}
+

Revision as of 18:18, 18 March 2018

Metabolite cis-cis-D13-25-3-oxo-C44-2-ACPs

  • common name:
    • a cis,cis-delta13,25-3-oxo-C44:2-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis,cis-delta13,25-3-oxo-C44:2-[acp" cannot be used as a page name in this wiki.