Difference between revisions of "AMMONIUM"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE ADENOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))) * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CTPSYN-RXN CTPSYN-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/E...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CTPSYN-RXN CTPSYN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/6.3.4.2 EC-6.3.4.2] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[ATP]][c] '''+''' 1 [[GLN]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[UTP]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[CTP]][c] '''+''' 1 [[GLT]][c] '''+''' 1 [[ADP]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 ATP[c] '''+''' 1 L-glutamine[c] '''+''' 1 H2O[c] '''+''' 1 UTP[c] '''=>''' 2 H+[c] '''+''' 1 phosphate[c] '''+''' 1 CTP[c] '''+''' 1 L-glutamate[c] '''+''' 1 ADP[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | + | == Pathways == | |
− | * [[ | + | * [[PWY-7185]], UTP and CTP dephosphorylation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7185 PWY-7185] |
− | * [[ | + | ** '''5''' reactions found over '''5''' reactions in the full pathway |
+ | * [[PWY-7176]], UTP and CTP de novo biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7176 PWY-7176] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-7177]], UTP and CTP dephosphorylation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7177 PWY-7177] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26426 26426] |
− | * | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00573 R00573] |
− | ** [http:// | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/Q58574 Q58574] |
− | * | + | ** [http://www.uniprot.org/uniprot/P44341 P44341] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9PJ84 Q9PJ84] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9JTK1 Q9JTK1] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P28595 P28595] |
− | * | + | ** [http://www.uniprot.org/uniprot/P28274 P28274] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P38627 P38627] |
− | * | + | ** [http://www.uniprot.org/uniprot/P53529 P53529] |
− | + | ** [http://www.uniprot.org/uniprot/P74208 P74208] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P13242 P13242] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0A7E5 P0A7E5] |
− | + | ** [http://www.uniprot.org/uniprot/P17812 P17812] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O64753 O64753] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O04252 O04252] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O65445 O65445] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O74638 O74638] |
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: ec number=EC-6.3.4.2}} | ||
+ | {{#set: in pathway=PWY-7185|PWY-7176|PWY-7177}} | ||
+ | {{#set: reconstruction category=manual|annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation|manual-primary_network|annotation-experimental_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 19:18, 18 March 2018
Contents
Reaction CTPSYN-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 ATP[c] + 1 L-glutamine[c] + 1 H2O[c] + 1 UTP[c] => 2 H+[c] + 1 phosphate[c] + 1 CTP[c] + 1 L-glutamate[c] + 1 ADP[c]
Genes associated with this reaction
Pathways
- PWY-7185, UTP and CTP dephosphorylation I: PWY-7185
- 5 reactions found over 5 reactions in the full pathway
- PWY-7176, UTP and CTP de novo biosynthesis: PWY-7176
- 3 reactions found over 3 reactions in the full pathway
- PWY-7177, UTP and CTP dephosphorylation II: PWY-7177
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: