Difference between revisions of "Cis-delta7-3-oxo-cerotoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7524 PWY-7524] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7524 PWY-7524] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
−
** InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N
+
 
* common name:
 
* common name:
−
** cholest-5-en-3-one
+
** mevalonate pathway III (archaea)
−
* molecular weight:
+
−
** 384.644   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''8''' reactions in the full pathway
−
* [[RXN-12693]]
+
* [[1.1.1.34-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_17889]]
 +
*** [[Tiso_gene_16182]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_16181]]
 +
*** [[Tiso_gene_15327]]
 +
*** [[Tiso_gene_17451]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_14303]]
 +
*** [[Tiso_gene_9236]]
 +
*** [[Tiso_gene_8563]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[IPPISOM-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8653]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10068 RXN-10068]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15647 RXN-15647]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15648 RXN-15648]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15649 RXN-15649]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9908107 9908107]
+
{{#set: common name=mevalonate pathway III (archaea)}}
−
* CHEBI:
+
{{#set: reaction found=4}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63906 63906]
+
{{#set: total reaction=8}}
−
* METABOLIGHTS : MTBLC63906
+
{{#set: completion rate=50.0}}
−
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N}}
+
−
{{#set: common name=cholest-5-en-3-one}}
+
−
{{#set: molecular weight=384.644    }}
+
−
{{#set: produced by=RXN-12693}}
+

Revision as of 18:18, 18 March 2018

Pathway PWY-7524

  • taxonomic range:
  • common name:
    • mevalonate pathway III (archaea)
  • Synonym(s):

Reaction(s) found

4 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cis-delta7-3-oxo-cerotoyl-ACPs&oldid=23367"