Difference between revisions of "PWY-4521"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] == * smiles: ** COP(OC1(=CC=C(C=C1)[N+](=O)[O-]))(OC)=S * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_614 == * Synonym(s): == Reactions associated == * ADCLY-RXN ** pantograph-creinhardtii == Pathways associated == * [[PWY-6543]...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_614 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * [[ADCLY-RXN]] |
| − | == | + | ** [[pantograph]]-[[creinhardtii]] |
| − | + | == Pathways associated == | |
| + | * [[PWY-6543]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=ADCLY-RXN}} | |
| − | + | {{#set: pathway associated=PWY-6543}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 18:18, 18 March 2018
Gene Tiso_gene_614
- Synonym(s):
