|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PEROXID-RXN PEROXID-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-667 CPD-667] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CC(OCCC(C([O-])=O)[N+])=O |
| + | * inchi key: |
| + | ** InChIKey=FCXZBWSIAGGPCB-YFKPBYRVSA-N |
| * common name: | | * common name: |
− | ** ascorbate_peroxidase | + | ** O-acetyl-L-homoserine |
− | ** ORF | + | * molecular weight: |
− | * ec number:
| + | ** 161.157 |
− | ** [http://enzyme.expasy.org/EC/1.11.1.7 EC-1.11.1.7] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** acetylhomoserine |
| + | ** O-acetylhomoserine |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[ACHMSSELCYSL]] |
− | ** 2 [[Phenolic-Donors]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''=>''' 2 [[WATER]][c] '''+''' 2 [[Phenoxyl-rad-of-phenolic-donors]][c]
| + | * [[ACHMSSELCYSLh]] |
− | * With common name(s):
| + | == Reaction(s) known to produce the compound == |
− | ** 2 a phenolic donor[c] '''+''' 1 hydrogen peroxide[c] '''=>''' 2 H2O[c] '''+''' 2 a phenoxyl radical of a phenolic donor[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | * [[ACETYLHOMOSER-CYS-RXN]] |
− | == Genes associated with this reaction ==
| + | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_19683]] | + | |
− | ** [[pantograph]]-[[esiliculosus]] | + | |
− | * [[Tiso_gene_11016]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_9359]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_15962]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_17551]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_15820]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_5857]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_6431]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_7067]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_16028]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_20206]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways == | + | |
− | == Reconstruction information == | + | |
− | * [[orthology]]: | + | |
− | ** [[pantograph]]:
| + | |
− | *** [[esiliculosus]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * UNIPROT: | + | * PUBCHEM: |
− | ** [http://www.uniprot.org/uniprot/P11678 P11678] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244888 25244888] |
− | ** [http://www.uniprot.org/uniprot/P80025 P80025]
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P22195 P22195]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57716 57716] |
− | ** [http://www.uniprot.org/uniprot/P11965 P11965] | + | * METABOLIGHTS : MTBLC57716 |
− | ** [http://www.uniprot.org/uniprot/P05164 P05164] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P22196 P22196]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01077 C01077] |
− | ** [http://www.uniprot.org/uniprot/P13029 P13029]
| + | {{#set: smiles=CC(OCCC(C([O-])=O)[N+])=O}} |
− | ** [http://www.uniprot.org/uniprot/Q42853 Q42853] | + | {{#set: inchi key=InChIKey=FCXZBWSIAGGPCB-YFKPBYRVSA-N}} |
− | ** [http://www.uniprot.org/uniprot/Q26059 Q26059] | + | {{#set: common name=O-acetyl-L-homoserine}} |
− | ** [http://www.uniprot.org/uniprot/O24081 O24081] | + | {{#set: molecular weight=161.157 }} |
− | ** [http://www.uniprot.org/uniprot/Q43790 Q43790]
| + | {{#set: common name=acetylhomoserine|O-acetylhomoserine}} |
− | ** [http://www.uniprot.org/uniprot/Q43791 Q43791]
| + | {{#set: consumed by=ACHMSSELCYSL|ACHMSSELCYSLh}} |
− | ** [http://www.uniprot.org/uniprot/O24080 O24080]
| + | {{#set: reversible reaction associated=ACETYLHOMOSER-CYS-RXN|HOMOSERINE-O-ACETYLTRANSFERASE-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P22079 P22079]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17179 P17179]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17180 P17180]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q24926 Q24926]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43854 Q43854]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14412 P14412]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24101 P24101]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24102 P24102]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00434 P00434]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00433 P00433]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S913 Q9S913]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S912 Q9S912]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S911 Q9S911]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15232 P15232]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15233 P15233]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15003 P15003]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15004 P15004]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15984 P15984]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11247 P11247]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12437 P12437]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06181 P06181]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19135 P19135]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05855 Q05855]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43212 Q43212]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42517 Q42517]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M1X2 Q7M1X2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01548 Q01548]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43006 Q43006]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40069 Q40069]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q16771 Q16771]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16147 P16147]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01603 Q01603]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12575 Q12575]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43774 Q43774]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42854 Q42854]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SMU8 Q9SMU8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43158 Q43158]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07446 Q07446]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43032 Q43032]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41577 Q41577]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43218 Q43218]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43219 Q43219]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43220 Q43220]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55110 Q55110]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96518 Q96518]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22510 O22510]
| + | |
− | ** [http://www.uniprot.org/uniprot/O80912 O80912]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40486 Q40486]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40487 Q40487]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40555 Q40555]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42964 Q42964]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43004 Q43004]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37834 P37834]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37835 P37835]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93675 P93675]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24523 O24523]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49866 O49866]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43731 Q43731]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SZE7 Q9SZE7]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22443 O22443]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SZB9 Q9SZB9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27337 P27337]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40068 Q40068]
| + | |
− | ** [http://www.uniprot.org/uniprot/O64970 O64970]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42784 Q42784]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43499 Q43499]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07445 Q07445]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22602 O22602]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65029 O65029]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93545 P93545]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93546 P93546]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93547 P93547]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93548 P93548]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93549 P93549]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93550 P93550]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93551 P93551]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93552 P93552]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93553 P93553]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49940 O49940]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49941 O49941]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49943 O49943]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49942 O49942]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40949 Q40949]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40950 Q40950]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40366 Q40366]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40367 Q40367]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24336 O24336]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39652 Q39652]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39653 Q39653]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08671 Q08671]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SUT2 Q9SUT2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96522 Q96522]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81266 O81266]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q20616 Q20616]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q23490 Q23490]
| + | |
− | ** [http://www.uniprot.org/uniprot/O59651 O59651]
| + | |
− | ** [http://www.uniprot.org/uniprot/O31066 O31066]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=ascorbate_peroxidase}} | + | |
− | {{#set: common name=ORF}} | + | |
− | {{#set: ec number=EC-1.11.1.7}} | + | |
− | {{#set: gene associated=Tiso_gene_19683|Tiso_gene_11016|Tiso_gene_9359|Tiso_gene_15962|Tiso_gene_17551|Tiso_gene_15820|Tiso_gene_5857|Tiso_gene_6431|Tiso_gene_7067|Tiso_gene_16028|Tiso_gene_20206}} | + | |
− | {{#set: in pathway=}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=esiliculosus}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=in-silico_annotation}}
| + | |