Difference between revisions of "MALSYN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UROPORPHYRINOGEN-III UROPORPHYRINOGEN-III] == * smiles: ** C(=O)([O-])CCC3(C(=C2(CC5(NC(CC4(NC(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] == * smiles: ** C1(=NC2(=C(NC1)N=C(N)NC(=O)2)) * inchi key: ** InChIKey=PX...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(=NC2(=C(NC1)N=C(N)NC(=O)2)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 7,8-dihydropterin |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 165.154 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** dihydropterin |
| + | ** H2-pterin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15261]] |
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65260 65260] |
| − | * | + | * CHEMSPIDER: |
| − | + | ** [http://www.chemspider.com/Chemical-Structure.58752.html 58752] | |
| − | ** [http://www. | + | {{#set: smiles=C1(=NC2(=C(NC1)N=C(N)NC(=O)2))}} |
| − | + | {{#set: inchi key=InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N}} | |
| − | + | {{#set: common name=7,8-dihydropterin}} | |
| − | + | {{#set: molecular weight=165.154 }} | |
| − | {{#set: smiles= | + | {{#set: common name=dihydropterin|H2-pterin}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: consumed by=RXN-15261}} |
| − | {{#set: common name= | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: consumed by=RXN- | + | |
| − | + | ||
Revision as of 18:19, 18 March 2018
Contents
Metabolite CPD0-1718
- smiles:
- C1(=NC2(=C(NC1)N=C(N)NC(=O)2))
- inchi key:
- InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N
- common name:
- 7,8-dihydropterin
- molecular weight:
- 165.154
- Synonym(s):
- dihydropterin
- H2-pterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
