Difference between revisions of "RXN-2962"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-cis-D19-37-C56-3-ACPs trans-D2-cis-cis-D19-37-C56-3-ACPs] == * common name: ** a t...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] == |
+ | * smiles: | ||
+ | ** [CH](=O)C(C(C(C(CO)O)O)O)O | ||
+ | * inchi key: | ||
+ | ** InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** aldehydo-D-glucose |
+ | * molecular weight: | ||
+ | ** 180.157 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal | ||
+ | ** linear D-glucose | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14408]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107526 107526] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42758 42758] | ||
+ | {{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}} | ||
+ | {{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N}} | ||
+ | {{#set: common name=aldehydo-D-glucose}} | ||
+ | {{#set: molecular weight=180.157 }} | ||
+ | {{#set: common name=(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal|linear D-glucose}} | ||
+ | {{#set: consumed by=RXN-14408}} |
Revision as of 19:19, 18 March 2018
Contents
Metabolite CPD-15374
- smiles:
- [CH](=O)C(C(C(C(CO)O)O)O)O
- inchi key:
- InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N
- common name:
- aldehydo-D-glucose
- molecular weight:
- 180.157
- Synonym(s):
- (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal
- linear D-glucose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(C(C(C(CO)O)O)O)O" cannot be used as a page name in this wiki.