Difference between revisions of "FRUCTOSE-16-DIPHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTANAL BUTANAL] == * smiles: ** CCC[CH]=O * inchi key: ** InChIKey=ZTQSAGDEMFDKMZ-UHFFFAOYSA-N...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == * smiles: ** CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1) * inchi key: ** InChIKey...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == |
* smiles: | * smiles: | ||
− | ** CCC[ | + | ** CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=BZXZFDKIRZBJEP-CLTKARDFSA-M |
* common name: | * common name: | ||
− | ** | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 293.425 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid |
− | ** | + | ** oxopentenyl-cyclopentane-octanoic acid |
− | ** | + | ** 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate |
− | ** | + | ** OPC8 |
+ | ** OPC-8:0 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10695]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | * | + | * LIPID_MAPS : LMFA02010006 |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244083 25244083] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49265 49265] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles=CCC[ | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04780 C04780] |
− | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB36217 |
− | {{#set: common name= | + | {{#set: smiles=CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1)}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=BZXZFDKIRZBJEP-CLTKARDFSA-M}} |
− | {{#set: common name= | + | {{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate}} |
− | { | + | {{#set: molecular weight=293.425 }} |
− | {{#set: consumed | + | {{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid|oxopentenyl-cyclopentane-octanoic acid|8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate|OPC8|OPC-8:0}} |
+ | {{#set: consumed by=RXN-10695}} |
Revision as of 18:19, 18 March 2018
Contents
Metabolite CPD-730
- smiles:
- CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1)
- inchi key:
- InChIKey=BZXZFDKIRZBJEP-CLTKARDFSA-M
- common name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
- molecular weight:
- 293.425
- Synonym(s):
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid
- oxopentenyl-cyclopentane-octanoic acid
- 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate
- OPC8
- OPC-8:0
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1)" cannot be used as a page name in this wiki.
"8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate" cannot be used as a page name in this wiki.