Difference between revisions of "GAPDHSYNEC-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1718 == * left end position: ** 4302 * transcription direction: ** POSITIVE * right end position: ** 8544 * centisome position: ** 19.48104...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3946 CPD-3946] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3946 CPD-3946] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=XGIZPVUTLMXXTK-VNSZYHACSA-N |
| − | * | + | * common name: |
| − | ** | + | ** (22S,24R)-22-hydroxy-5α-ergostan-3-one |
| − | * | + | * molecular weight: |
| − | ** | + | ** 416.686 |
* Synonym(s): | * Synonym(s): | ||
| + | ** (22S)-22-hydroxy-5α-campestan-3-one | ||
| + | ** (22α)-hydroxy-5α-campestan-3-one | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-4230]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * LIPID_MAPS : LMST01031117 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878488 46878488] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59411 59411] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15797 C15797] | ||
| + | * HMDB : HMDB12112 | ||
| + | {{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: inchi key=InChIKey=XGIZPVUTLMXXTK-VNSZYHACSA-N}} | ||
| + | {{#set: common name=(22S,24R)-22-hydroxy-5α-ergostan-3-one}} | ||
| + | {{#set: molecular weight=416.686 }} | ||
| + | {{#set: common name=(22S)-22-hydroxy-5α-campestan-3-one|(22α)-hydroxy-5α-campestan-3-one}} | ||
| + | {{#set: produced by=RXN-4230}} | ||
Revision as of 18:19, 18 March 2018
Contents
Metabolite CPD-3946
- smiles:
- CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=XGIZPVUTLMXXTK-VNSZYHACSA-N
- common name:
- (22S,24R)-22-hydroxy-5α-ergostan-3-one
- molecular weight:
- 416.686
- Synonym(s):
- (22S)-22-hydroxy-5α-campestan-3-one
- (22α)-hydroxy-5α-campestan-3-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
