Difference between revisions of "PWY4FS-11"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...")
(Created page with "Category:Gene == Gene Tiso_gene_2309 == * left end position: ** 12293 * transcription direction: ** POSITIVE * right end position: ** 15663 * centisome position: ** 56.217...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] ==
+
== Gene Tiso_gene_2309 ==
* smiles:
+
* left end position:
** [CH](=O)C(C(C(C(CO)O)O)O)O
+
** 12293
* inchi key:
+
* transcription direction:
** InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N
+
** POSITIVE
* common name:
+
* right end position:
** aldehydo-D-glucose
+
** 15663
* molecular weight:
+
* centisome position:
** 180.157    
+
** 56.21713    
 
* Synonym(s):
 
* Synonym(s):
** (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal
 
** linear D-glucose
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14408]]
+
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=12293}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107526 107526]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: right end position=15663}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42758 42758]
+
{{#set: centisome position=56.21713   }}
{{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}}
+
{{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N}}
+
{{#set: common name=aldehydo-D-glucose}}
+
{{#set: molecular weight=180.157   }}
+
{{#set: common name=(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal|linear D-glucose}}
+
{{#set: consumed by=RXN-14408}}
+

Revision as of 18:19, 18 March 2018

Gene Tiso_gene_2309

  • left end position:
    • 12293
  • transcription direction:
    • POSITIVE
  • right end position:
    • 15663
  • centisome position:
    • 56.21713
  • Synonym(s):

Reactions associated

Pathways associated

External links