Difference between revisions of "PWY4FS-11"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...") |
(Created page with "Category:Gene == Gene Tiso_gene_2309 == * left end position: ** 12293 * transcription direction: ** POSITIVE * right end position: ** 15663 * centisome position: ** 56.217...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2309 == |
− | * | + | * left end position: |
− | ** | + | ** 12293 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 15663 |
− | * | + | * centisome position: |
− | ** | + | ** 56.21713 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]] |
− | + | ** in-silico_annotation | |
− | == | + | ***ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=12293}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=15663}} | |
− | + | {{#set: centisome position=56.21713 }} | |
− | {{#set: | + | {{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:19, 18 March 2018
Gene Tiso_gene_2309
- left end position:
- 12293
- transcription direction:
- POSITIVE
- right end position:
- 15663
- centisome position:
- 56.21713
- Synonym(s):
Reactions associated
- NAD+-ADP-RIBOSYLTRANSFERASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation