Difference between revisions of "TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE SUCROSE] == * smiles: ** C(C2(OC(OC1(OC(CO)C(C(O)1)O)CO)C(C(O)C2O)O))O * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-184 RXN1G-184] == * direction: ** LEFT-TO-RIGHT * common name: ** cis,cis-delta17,35-3-oxo-C5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE SUCROSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-184 RXN1G-184] ==
−
* smiles:
+
* direction:
−
** C(C2(OC(OC1(OC(CO)C(C(O)1)O)CO)C(C(O)C2O)O))O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=CZMRCDWAGMRECN-UGDNZRGBSA-N
+
 
* common name:
 
* common name:
−
** sucrose
+
** cis,cis-delta17,35-3-oxo-C54:2-[acyl-carrier protein] reductase
−
* molecular weight:
+
* ec number:
−
** 342.299   
+
** [http://enzyme.expasy.org/EC/1.1.1.M9 EC-1.1.1.M9]
 
* Synonym(s):
 
* Synonym(s):
−
** saccharose
 
−
** Glc(α1->2β)Fru
 
−
** β-D-fructofuranosyl-(2↔1)-α-D-glucopyranoside
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[3.2.1.48-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[cis-cis-D17-35-3-oxo-C54-2-ACPs]][c] '''=>''' 1 [[cis-cis-D17-35-3-hydroxyC54-2-ACPs]][c] '''+''' 1 [[NADP]][c]
−
* [[RXN-11502]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 a cis,cis-delta17,35-3-oxo-C54:2-[acp][c] '''=>''' 1 a cis,cis-delta17,35-3-hydroxyC54:2-[acp][c] '''+''' 1 NADP+[c]
−
* [[2.4.1.125-RXN]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_13083]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=406942 406942]
+
{{#set: common name=cis,cis-delta17,35-3-oxo-C54:2-[acyl-carrier protein] reductase}}
−
* CAS : 57-50-1
+
{{#set: ec number=EC-1.1.1.M9}}
−
* METABOLIGHTS : MTBLC17992
+
{{#set: gene associated=Tiso_gene_13083}}
−
* DRUGBANK : DB02772
+
{{#set: in pathway=PWYG-321}}
−
* PUBCHEM:
+
{{#set: reconstruction category=orthology}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5988 5988]
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
* KEGG-GLYCAN : G00370
+
{{#set: reconstruction tool=pantograph}}
−
* HMDB : HMDB00258
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00089 C00089]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5768.html 5768]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17992 17992]
+
−
* BIGG : sucr
+
−
{{#set: smiles=C(C2(OC(OC1(OC(CO)C(C(O)1)O)CO)C(C(O)C2O)O))O}}
+
−
{{#set: inchi key=InChIKey=CZMRCDWAGMRECN-UGDNZRGBSA-N}}
+
−
{{#set: common name=sucrose}}
+
−
{{#set: molecular weight=342.299    }}
+
−
{{#set: common name=saccharose|Glc(α1->2β)Fru|β-D-fructofuranosyl-(2↔1)-α-D-glucopyranoside}}
+
−
{{#set: consumed by=3.2.1.48-RXN}}
+
−
{{#set: produced by=RXN-11502}}
+
−
{{#set: consumed or produced by=2.4.1.125-RXN}}
+

Revision as of 18:19, 18 March 2018

Reaction RXN1G-184

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cis,cis-delta17,35-3-oxo-C54:2-[acyl-carrier protein] reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"cis,cis-delta17,35-3-oxo-C54:2-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN&oldid=23523"