Difference between revisions of "GLUTAMIDOTRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLEYL-CPD INDOLEYL-CPD] == * smiles: ** C2(NC1(C=CC=CC=1C(CC#N)=2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Tiso_gene_6110 == * left end position: ** 9466 * transcription direction: ** NEGATIVE * right end position: ** 12606 * centisome position: ** 65.9008...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6110 == |
− | * | + | * left end position: |
− | ** | + | ** 9466 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 12606 |
− | * | + | * centisome position: |
− | ** | + | ** 65.90086 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[ACSERLY-RXN]] |
− | * [[RXN- | + | ** in-silico_annotation |
− | + | ***ec-number | |
− | == | + | ** experimental_annotation |
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | * [[RXN-12726]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | * [[SULFOCYS-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[CYSTSYN-PWY]] | ||
+ | * [[PWY-6936]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=9466}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=12606}} | |
− | + | {{#set: centisome position=65.90086 }} | |
− | + | {{#set: reaction associated=ACSERLY-RXN|RXN-12726|SULFOCYS-RXN}} | |
− | + | {{#set: pathway associated=CYSTSYN-PWY|PWY-6936}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:19, 18 March 2018
Gene Tiso_gene_6110
- left end position:
- 9466
- transcription direction:
- NEGATIVE
- right end position:
- 12606
- centisome position:
- 65.90086
- Synonym(s):
Reactions associated
- ACSERLY-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-synechocystis
- pantograph-esiliculosus
- pantograph-creinhardtii
- in-silico_annotation
- RXN-12726
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-athaliana
- pantograph-esiliculosus
- pantograph-creinhardtii
- pantograph-creinhardtii
- pantograph-creinhardtii
- in-silico_annotation
- SULFOCYS-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-athaliana
- pantograph-esiliculosus
- pantograph-creinhardtii
- pantograph-creinhardtii
- pantograph-creinhardtii
- in-silico_annotation