Difference between revisions of "L-GLN-FRUCT-6-P-AMINOTRANS-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE PYRIDOXINE] == * smiles: ** CC1(=NC=C(C(=C1O)CO)CO) * inchi key: ** InChIKey=LXNHXLL...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta9-montanoyl-ACPs cis-delta9-montanoyl-ACPs] == * common name: ** a cis-delta9-C28:1-[a...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE PYRIDOXINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta9-montanoyl-ACPs cis-delta9-montanoyl-ACPs] ==
−
* smiles:
+
−
** CC1(=NC=C(C(=C1O)CO)CO)
+
−
* inchi key:
+
−
** InChIKey=LXNHXLLTXMVWPM-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** pyridoxine
+
** a cis-delta9-C28:1-[acp]
−
* molecular weight:
+
−
** 169.18   
+
 
* Synonym(s):
 
* Synonym(s):
−
** vitamin B6
 
−
** 2-methyl-3-hydroxy-4,5-bis(hydroxy-methyl) pyridine
 
−
** pyridoxol
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[PNKIN-RXN]]
+
* [[RXN1G-138]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-14181]]
+
* [[RXN1G-285]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[PYRIDOXINE-4-DEHYDROGENASE-RXN]]
 
 
== External links  ==
 
== External links  ==
−
* CAS : 65-23-6
+
{{#set: common name=a cis-delta9-C28:1-[acp]}}
−
* METABOLIGHTS : MTBLC16709
+
{{#set: consumed by=RXN1G-138}}
−
* DRUGBANK : DB00165
+
{{#set: produced by=RXN1G-285}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1054 1054]
+
−
* HMDB : HMDB00239
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00314 C00314]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.1025.html 1025]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16709 16709]
+
−
* BIGG : pydxn
+
−
{{#set: smiles=CC1(=NC=C(C(=C1O)CO)CO)}}
+
−
{{#set: inchi key=InChIKey=LXNHXLLTXMVWPM-UHFFFAOYSA-N}}
+
−
{{#set: common name=pyridoxine}}
+
−
{{#set: molecular weight=169.18    }}
+
−
{{#set: common name=vitamin B6|2-methyl-3-hydroxy-4,5-bis(hydroxy-methyl) pyridine|pyridoxol}}
+
−
{{#set: consumed by=PNKIN-RXN}}
+
−
{{#set: produced by=RXN-14181}}
+
−
{{#set: consumed or produced by=PYRIDOXINE-4-DEHYDROGENASE-RXN}}
+

Revision as of 18:21, 18 March 2018

Metabolite cis-delta9-montanoyl-ACPs

  • common name:
    • a cis-delta9-C28:1-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis-delta9-C28:1-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=L-GLN-FRUCT-6-P-AMINOTRANS-RXN&oldid=23693"