Difference between revisions of "GDRh"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C...")
(Created page with "Category:Gene == Gene Tiso_gene_2280 == * Synonym(s): == Reactions associated == * 1.14.11.2-RXN ** pantograph-esiliculosus * RXN490-3641 ** [[pantograph]...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] ==
+
== Gene Tiso_gene_2280 ==
* smiles:
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N
+
* common name:
+
** 6-hydroxytyphasterol
+
* molecular weight:
+
** 450.701   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[1.14.11.2-RXN]]
* [[RXN-4241]]
+
** [[pantograph]]-[[esiliculosus]]
== Reaction(s) of unknown directionality ==
+
* [[RXN490-3641]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=1.14.11.2-RXN|RXN490-3641}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515372 102515372]
+
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N}}
+
{{#set: common name=6-hydroxytyphasterol}}
+
{{#set: molecular weight=450.701    }}
+
{{#set: produced by=RXN-4241}}
+

Revision as of 18:21, 18 March 2018

Gene Tiso_gene_2280

  • Synonym(s):

Reactions associated

Pathways associated

External links