Difference between revisions of "PWY-5857"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13707 RXN-13707] == * direction: ** LEFT-TO-RIGHT * common name: ** 24,25-dihydrolanosterol 14-...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13707 RXN-13707] ==
* smiles:
+
* direction:
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L
+
 
* common name:
 
* common name:
** gibberellin44 (open lactone form)
+
** 24,25-dihydrolanosterol 14-demethylase
* molecular weight:
+
* ec number:
** 362.422   
+
** [http://enzyme.expasy.org/EC/1.14.13.70 EC-1.14.13.70]
 
* Synonym(s):
 
* Synonym(s):
** gibberellin A44 open lactone
 
** gibberellin A44 diacid
 
** GA44 open lactone
 
** GA44 (open lactone form)
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN1F-168]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 2 [[PROTON]][c] '''+''' 1 [[CPD-8606]][c] '''+''' 3 [[NADPH]][c] '''+''' 3 [[OXYGEN-MOLECULE]][c] '''=>''' 3 [[NADP]][c] '''+''' 1 [[CPD-8609]][c] '''+''' 4 [[WATER]][c] '''+''' 1 [[FORMATE]][c]
* [[RXN1F-167]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 2 H+[c] '''+''' 1 24,25-dihydrolanosterol[c] '''+''' 3 NADPH[c] '''+''' 3 oxygen[c] '''=>''' 3 NADP+[c] '''+''' 1 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol[c] '''+''' 4 H2O[c] '''+''' 1 formate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_8263]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104170008
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=24,25-dihydrolanosterol 14-demethylase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243940 25243940]
+
{{#set: ec number=EC-1.14.13.70}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_8263}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27531 27531]
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C06095 C06095]
+
{{#set: reconstruction source=orthology-esiliculosus}}
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: inchi key=InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L}}
+
{{#set: common name=gibberellin44 (open lactone form)}}
+
{{#set: molecular weight=362.422    }}
+
{{#set: common name=gibberellin A44 open lactone|gibberellin A44 diacid|GA44 open lactone|GA44 (open lactone form)}}
+
{{#set: consumed by=RXN1F-168}}
+
{{#set: produced by=RXN1F-167}}
+

Revision as of 18:21, 18 March 2018

Reaction RXN-13707

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 24,25-dihydrolanosterol 14-demethylase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 2 H+[c] + 1 24,25-dihydrolanosterol[c] + 3 NADPH[c] + 3 oxygen[c] => 3 NADP+[c] + 1 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol[c] + 4 H2O[c] + 1 formate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links