Difference between revisions of "PWY-6608"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18523 == * Synonym(s): == Reactions associated == * 2.7.10.1-RXN ** pantograph-esiliculosus * 3.6.4.4-RXN ** [[pantograph]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == * smiles: ** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == |
+ | * smiles: | ||
+ | ** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O) | ||
+ | * inchi key: | ||
+ | ** InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L | ||
+ | * common name: | ||
+ | ** GDP-β-L-fucose | ||
+ | * molecular weight: | ||
+ | ** 587.33 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[1.1.1.271-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244478 25244478] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57273 57273] | ||
+ | {{#set: smiles=CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)}} | ||
+ | {{#set: inchi key=InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L}} | ||
+ | {{#set: common name=GDP-β-L-fucose}} | ||
+ | {{#set: molecular weight=587.33 }} | ||
+ | {{#set: produced by=1.1.1.271-RXN}} |
Revision as of 18:22, 18 March 2018
Contents
Metabolite CPD-13118
- smiles:
- CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)
- inchi key:
- InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L
- common name:
- GDP-β-L-fucose
- molecular weight:
- 587.33
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)" cannot be used as a page name in this wiki.