Difference between revisions of "Tiso gene 13560"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)...")
(Created page with "Category:Gene == Gene Tiso_gene_3236 == * left end position: ** 4858 * transcription direction: ** NEGATIVE * right end position: ** 16906 * centisome position: ** 28.3067...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] ==
+
== Gene Tiso_gene_3236 ==
* smiles:
+
* left end position:
** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
+
** 4858
* inchi key:
+
* transcription direction:
** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
+
** NEGATIVE
* common name:
+
* right end position:
** cycloartenol
+
** 16906
* molecular weight:
+
* centisome position:
** 426.724    
+
** 28.306726    
 
* Synonym(s):
 
* Synonym(s):
** 9β,19-cyclo-24-lanosten-3β-ol
 
** cycloart-24(25)-enol
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-4021]]
+
* [[UDPGLUCEPIM-RXN]]
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
* [[CYCLOARTENOL-SYNTHASE-RXN]]
+
***automated-name-match
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[synechocystis]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7344]]
 +
* [[PWY-6397]]
 +
* [[COLANSYN-PWY]]
 +
* [[PWY-6527]]
 +
* [[PWY-7328]]
 +
* [[PWY-6317]]
 +
* [[PWY66-422]]
 +
* [[PWY-3821]]
 
== External links  ==
 
== External links  ==
* CAS : 469-38-5
+
{{#set: left end position=4858}}
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44434254 44434254]
+
{{#set: right end position=16906}}
* CHEBI:
+
{{#set: centisome position=28.306726   }}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030]
+
{{#set: reaction associated=UDPGLUCEPIM-RXN}}
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7344|PWY-6397|COLANSYN-PWY|PWY-6527|PWY-7328|PWY-6317|PWY66-422|PWY-3821}}
** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902]
+
* HMDB : HMDB36591
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
+
{{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}}
+
{{#set: common name=cycloartenol}}
+
{{#set: molecular weight=426.724   }}
+
{{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}}
+
{{#set: consumed by=RXN-4021}}
+
{{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}}
+

Revision as of 18:22, 18 March 2018

Gene Tiso_gene_3236

  • left end position:
    • 4858
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 16906
  • centisome position:
    • 28.306726
  • Synonym(s):

Reactions associated

Pathways associated

External links