Difference between revisions of "Tiso gene 4345"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14882 RXN-14882] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17932 CPD-17932] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17932 CPD-17932] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC4(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC([N+])C([O-])=O)C(NC(C)C(=O)NC(C([O-])=O)CCCC(C(NC(C)C([O-])=O)=O)NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC2(C(OC1(OC(CO)C(O[R3])C(O)C(NC(=O)C)1))C(CO)OC(C(NC(=O)C)2)O[R2]))=O)C(OC3(OC(CO)C(O[R1])C(O)C(NC(=O)C)3))C(CO)O4))([O-])=O)C)C)C)C)C)C)C |
+ | * common name: | ||
+ | ** a nascent peptidoglycan with D,D cross-links (meso-diaminopimelate containing) | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-16659]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819739 91819739] | |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC4(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC([N+])C([O-])=O)C(NC(C)C(=O)NC(C([O-])=O)CCCC(C(NC(C)C([O-])=O)=O)NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC2(C(OC1(OC(CO)C(O[R3])C(O)C(NC(=O)C)1))C(CO)OC(C(NC(=O)C)2)O[R2]))=O)C(OC3(OC(CO)C(O[R1])C(O)C(NC(=O)C)3))C(CO)O4))([O-])=O)C)C)C)C)C)C)C}} |
− | {{#set: | + | {{#set: common name=a nascent peptidoglycan with D,D cross-links (meso-diaminopimelate containing)}} |
− | {{#set: | + | {{#set: produced by=RXN-16659}} |
Revision as of 18:22, 18 March 2018
Contents
Metabolite CPD-17932
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC4(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC([N+])C([O-])=O)C(NC(C)C(=O)NC(C([O-])=O)CCCC(C(NC(C)C([O-])=O)=O)NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC2(C(OC1(OC(CO)C(O[R3])C(O)C(NC(=O)C)1))C(CO)OC(C(NC(=O)C)2)O[R2]))=O)C(OC3(OC(CO)C(O[R1])C(O)C(NC(=O)C)3))C(CO)O4))([O-])=O)C)C)C)C)C)C)C
- common name:
- a nascent peptidoglycan with D,D cross-links (meso-diaminopimelate containing)
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC4(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC([N+])C([O-])=O)C(NC(C)C(=O)NC(C([O-])=O)CCCC(C(NC(C)C([O-])=O)=O)NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC2(C(OC1(OC(CO)C(O[R3])C(O)C(NC(=O)C)1))C(CO)OC(C(NC(=O)C)2)O[R2]))=O)C(OC3(OC(CO)C(O[R1])C(O)C(NC(=O)C)3))C(CO)O4))([O-])=O)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.