Difference between revisions of "1.1.1.271-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * smiles: ** C(=O)([O-])C(OP(=O)([O-])[O-])CO * inchi key: ** InChIKey=GXIURPTVHJ...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7007 PWY-7007] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7007 PWY-7007] ==
−
* smiles:
+
* taxonomic range:
−
** C(=O)([O-])C(OP(=O)([O-])[O-])CO
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K
+
 
* common name:
 
* common name:
−
** 2-phospho-D-glycerate
+
** methyl ketone biosynthesis (engineered)
−
* molecular weight:
+
−
** 183.034   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-phospho-(D)-glycerate
 
−
** 2-phospho-(R)-glycerate
 
−
** 2-phospho-D-glyceric acid
 
−
** 2-P-D-glycerate
 
−
** D-Glycerate 2-phosphate
 
−
** D-2-phosphoglycerate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''6''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[ACYL-COA-OXIDASE-RXN]]
−
* [[3PGAREARR-RXN]]
+
** 1 associated gene(s):
−
* [[2PGADEHYDRAT-RXN]]
+
*** [[Tiso_gene_18566]]
−
* [[RXN-15513]]
+
** 2 reconstruction source(s) associated:
−
* [[RXN-15510]]
+
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[ENOYL-COA-HYDRAT-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_14262]]
 +
*** [[Tiso_gene_16145]]
 +
*** [[Tiso_gene_6885]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[OHACYL-COA-DEHYDROG-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_14262]]
 +
*** [[Tiso_gene_14027]]
 +
*** [[Tiso_gene_18838]]
 +
*** [[Tiso_gene_18839]]
 +
*** [[Tiso_gene_14026]]
 +
*** [[Tiso_gene_5857]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=BUTYRATE--COA-LIGASE-RXN BUTYRATE--COA-LIGASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13247 RXN-13247]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13248 RXN-13248]
 
== External links  ==
 
== External links  ==
−
* CAS : 2553-59-5
+
{{#set: taxonomic range=TAX-2759}}
−
* METABOLIGHTS : MTBLC58289
+
{{#set: taxonomic range=TAX-2}}
−
* PUBCHEM:
+
{{#set: common name=methyl ketone biosynthesis (engineered)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40467846 40467846]
+
{{#set: reaction found=3}}
−
* HMDB : HMDB03391
+
{{#set: total reaction=6}}
−
* LIGAND-CPD:
+
{{#set: completion rate=50.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00631 C00631]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58289 58289]
+
−
* BIGG : 2pg
+
−
{{#set: smiles=C(=O)([O-])C(OP(=O)([O-])[O-])CO}}
+
−
{{#set: inchi key=InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K}}
+
−
{{#set: common name=2-phospho-D-glycerate}}
+
−
{{#set: molecular weight=183.034    }}
+
−
{{#set: common name=2-phospho-(D)-glycerate|2-phospho-(R)-glycerate|2-phospho-D-glyceric acid|2-P-D-glycerate|D-Glycerate 2-phosphate|D-2-phosphoglycerate}}
+
−
{{#set: consumed or produced by=3PGAREARR-RXN|2PGADEHYDRAT-RXN|RXN-15513|RXN-15510}}
+

Revision as of 18:22, 18 March 2018

Pathway PWY-7007

  • taxonomic range:
  • common name:
    • methyl ketone biosynthesis (engineered)
  • Synonym(s):

Reaction(s) found

3 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=1.1.1.271-RXN&oldid=23850"