Difference between revisions of "RXN-14223"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14223 RXN-14223] == * direction: ** REVERSIBLE * common name: ** ORF ** at1g17160 ** ribokinase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * inchi key: ** InChIKey=WHUUTDBJXJR...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(CCC(C(=O)[O-])[N+])([O-])=O |
| + | * inchi key: | ||
| + | ** InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** D-glutamate |
| − | * | + | * molecular weight: |
| − | + | ** 146.122 | |
| − | + | ||
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| + | ** D-glutamic acid | ||
| + | ** D-glu | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[D-ALANINE-AMINOTRANSFERASE-RXN]] | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * CAS : 6893-26-1 |
| − | ** [http:// | + | * PUBCHEM: |
| − | * LIGAND- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460297 5460297] |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * HMDB : HMDB03339 |
| − | + | * LIGAND-CPD: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00217 C00217] | |
| − | + | * CHEBI: | |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29986 29986] |
| − | + | * BIGG : glu__D | |
| − | + | {{#set: smiles=C(CCC(C(=O)[O-])[N+])([O-])=O}} | |
| − | {{#set: | + | {{#set: inchi key=InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M}} |
| − | + | {{#set: common name=D-glutamate}} | |
| − | {{#set: | + | {{#set: molecular weight=146.122 }} |
| − | {{#set: | + | {{#set: common name=D-glutamic acid|D-glu}} |
| − | {{#set: | + | {{#set: reversible reaction associated=D-ALANINE-AMINOTRANSFERASE-RXN}} |
| − | {{#set: | + | |
| − | + | ||
Revision as of 18:23, 18 March 2018
Contents
Metabolite D-GLT
- smiles:
- C(CCC(C(=O)[O-])[N+])([O-])=O
- inchi key:
- InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M
- common name:
- D-glutamate
- molecular weight:
- 146.122
- Synonym(s):
- D-glutamic acid
- D-glu
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CCC(C(=O)[O-])[N+])([O-])=O" cannot be used as a page name in this wiki.
