Difference between revisions of "Tiso gene 857"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSINE INOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARGASEDEG-PWY ARGASEDEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARGASEDEG-PWY ARGASEDEG-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* common name: | * common name: | ||
| − | ** | + | ** L-arginine degradation I (arginase pathway) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-arginase degradative pathway |
| − | ** | + | ** L-glutamate biosynthesis |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''3''' reactions found over '''3''' reactions in the full pathway |
| − | + | * [[ARGINASE-RXN]] | |
| − | * [[ | + | ** 1 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_4415]] |
| − | * [[ | + | ** 4 reconstruction source(s) associated: |
| − | + | *** [[annotation-in-silico_annotation]] | |
| − | * [[ | + | *** [[orthology-athaliana]] |
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_11231]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-synechocystis]] | ||
| + | * [[RXN-14116]] | ||
| + | ** 8 associated gene(s): | ||
| + | *** [[Tiso_gene_18337]] | ||
| + | *** [[Tiso_gene_18338]] | ||
| + | *** [[Tiso_gene_886]] | ||
| + | *** [[Tiso_gene_9680]] | ||
| + | *** [[Tiso_gene_6952]] | ||
| + | *** [[Tiso_gene_16634]] | ||
| + | *** [[Tiso_gene_3513]] | ||
| + | *** [[Tiso_gene_7381]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-3193}} | |
| − | + | {{#set: taxonomic range=TAX-33208}} | |
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=L-arginine degradation I (arginase pathway)}} | |
| − | + | {{#set: common name=L-arginase degradative pathway|L-glutamate biosynthesis}} | |
| − | + | {{#set: reaction found=3}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:23, 18 March 2018
Pathway ARGASEDEG-PWY
- taxonomic range:
- common name:
- L-arginine degradation I (arginase pathway)
- Synonym(s):
- L-arginase degradative pathway
- L-glutamate biosynthesis
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- ARGINASE-RXN
- 1 associated gene(s):
- 4 reconstruction source(s) associated:
- ORNITHINE-GLU-AMINOTRANSFERASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-14116
- 8 associated gene(s):
- 3 reconstruction source(s) associated:
