Difference between revisions of "PWY-5115"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ATROPINE ATROPINE] == * smiles: ** C[N+]1(C2(CC(CC1CC2)OC(=O)C(CO)C3(C=CC=CC=3))) * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5741 PWY-5741] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5741 PWY-5741] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ethylmalonyl-CoA pathway |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ethylmalonyl pathway |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''2''' reactions found over '''11''' reactions in the full pathway |
− | == Reaction(s) | + | * [[ACETYL-COA-ACETYLTRANSFER-RXN]] |
− | == | + | ** 3 associated gene(s): |
+ | *** [[Tiso_gene_16181]] | ||
+ | *** [[Tiso_gene_15327]] | ||
+ | *** [[Tiso_gene_17451]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-5901]] | ||
+ | ** 9 associated gene(s): | ||
+ | *** [[Tiso_gene_6562]] | ||
+ | *** [[Tiso_gene_136]] | ||
+ | *** [[Tiso_gene_500]] | ||
+ | *** [[Tiso_gene_5425]] | ||
+ | *** [[Tiso_gene_6563]] | ||
+ | *** [[Tiso_gene_135]] | ||
+ | *** [[Tiso_gene_10876]] | ||
+ | *** [[Tiso_gene_5424]] | ||
+ | *** [[Tiso_gene_13394]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXBUTYRYL-COA-DEHYDRATASE-RXN 3-HYDROXBUTYRYL-COA-DEHYDRATASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=MALATE--COA-LIGASE-RXN MALATE--COA-LIGASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=MALYL-COA-LYASE-RXN MALYL-COA-LYASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16391 RXN-16391] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8957 RXN-8957] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8958 RXN-8958] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8959 RXN-8959] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8960 RXN-8960] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8961 RXN-8961] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=ethylmalonyl-CoA pathway}} | |
− | + | {{#set: common name=ethylmalonyl pathway}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=11}} | |
− | + | {{#set: completion rate=18.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:23, 18 March 2018
Pathway PWY-5741
- taxonomic range:
- common name:
- ethylmalonyl-CoA pathway
- Synonym(s):
- ethylmalonyl pathway
Reaction(s) found
2 reactions found over 11 reactions in the full pathway
- ACETYL-COA-ACETYLTRANSFER-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- RXN-5901
- 9 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- 3-HYDROXBUTYRYL-COA-DEHYDRATASE-RXN
- MALATE--COA-LIGASE-RXN
- MALYL-COA-LYASE-RXN
- RXN-16391
- RXN-8957
- RXN-8958
- RXN-8959
- RXN-8960
- RXN-8961