Difference between revisions of "Tiso gene 9927"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-OHMYR-GLUCOSAMINE UDP-OHMYR-GLUCOSAMINE] == * smiles: ** CCCCCCCCCCCC(CC(OC3(C(C(OP(=O)([O-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE-6P SUCROSE-6P] == * smiles: ** C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE-6P SUCROSE-6P] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)2) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PJTTXANTBQDXME-UGDNZRGBSA-L |
* common name: | * common name: | ||
− | ** | + | ** sucrose 6F-phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 420.263 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** sucrose-6F-P |
− | ** | + | ** 6-O-phosphonato-β-D-fructofuranosyl α-D-glucopyranoside |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[BFFS]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[SUCROSE-PHOSPHATE-SYNTHASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245080 25245080] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57723 57723] |
− | * BIGG : | + | * BIGG : suc6p |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02591 C02591] |
− | {{#set: smiles= | + | {{#set: smiles=C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)2)}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=PJTTXANTBQDXME-UGDNZRGBSA-L}} |
− | {{#set: common name= | + | {{#set: common name=sucrose 6F-phosphate}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=420.263 }} |
− | {{#set: common name= | + | {{#set: common name=sucrose-6F-P|6-O-phosphonato-β-D-fructofuranosyl α-D-glucopyranoside}} |
− | {{#set: consumed by= | + | {{#set: consumed by=BFFS}} |
− | {{#set: produced by= | + | {{#set: produced by=SUCROSE-PHOSPHATE-SYNTHASE-RXN}} |
Revision as of 18:23, 18 March 2018
Contents
Metabolite SUCROSE-6P
- smiles:
- C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)2)
- inchi key:
- InChIKey=PJTTXANTBQDXME-UGDNZRGBSA-L
- common name:
- sucrose 6F-phosphate
- molecular weight:
- 420.263
- Synonym(s):
- sucrose-6F-P
- 6-O-phosphonato-β-D-fructofuranosyl α-D-glucopyranoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)2)" cannot be used as a page name in this wiki.