Difference between revisions of "CPD0-2189"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASP-tRNAs ASP-tRNAs] == * common name: ** tRNAasp * Synonym(s): ** TRNA(ASP) == Reaction(s) kn...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] == * smiles: ** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3)) * inchi key: **...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASP-tRNAs ASP-tRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] ==
 +
* smiles:
 +
** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))
 +
* inchi key:
 +
** InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N
 
* common name:
 
* common name:
** tRNAasp
+
** cyclobutadipyrimidine
 +
* molecular weight:
 +
** 238.246   
 
* Synonym(s):
 
* Synonym(s):
** TRNA(ASP)
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPARTATE--TRNA-LIGASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.2.2.17-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=tRNAasp}}
+
* PUBCHEM:
{{#set: common name=TRNA(ASP)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659235 90659235]
{{#set: consumed by=ASPARTATE--TRNA-LIGASE-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38923 38923]
 +
{{#set: smiles=CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))}}
 +
{{#set: inchi key=InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N}}
 +
{{#set: common name=cyclobutadipyrimidine}}
 +
{{#set: molecular weight=238.246    }}
 +
{{#set: produced by=3.2.2.17-RXN}}

Revision as of 18:24, 18 March 2018

Metabolite CPD-15526

  • smiles:
    • CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))
  • inchi key:
    • InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N
  • common name:
    • cyclobutadipyrimidine
  • molecular weight:
    • 238.246
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links