|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.14.11.2-RXN 1.14.11.2-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Methyl-Adenines 3-Methyl-Adenines] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CN1(C2(=NC=NC(=C(N)N=C1)2)) |
| + | * inchi key: |
| + | ** InChIKey=FSASIHFSFGAIJM-UHFFFAOYSA-N |
| * common name: | | * common name: |
− | ** prolyl_4-hydroxylase | + | ** 3-methyladenine |
− | ** ORF | + | * molecular weight: |
− | * ec number:
| + | ** 149.155 |
− | ** [http://enzyme.expasy.org/EC/1.14.11.2 EC-1.14.11.2] | + | |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[PROCOLLAGEN-L-PROLINE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-6321]][c] '''+''' 1 [[SUC]][c]
| + | * [[RXN0-5189]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 oxygen[c] '''+''' 1 2-oxoglutarate[c] '''+''' 1 a [procollagen]-L-proline[c] '''=>''' 1 CO2[c] '''+''' 1 a [procollagen] trans 4-hyroxy-L-proline[c] '''+''' 1 succinate[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_4246]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_17823]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_18933]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_16122]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_18235]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_292]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_15594]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_9035]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_18208]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_18145]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_15328]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_6296]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_3021]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_17593]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_2280]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_9165]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_9873]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_17919]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_9636]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_18689]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_16842]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_19638]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_9227]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_9455]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_1468]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_13008]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_2158]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_8652]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways == | + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[esiliculosus]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[experimental_annotation]]
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * LIGAND-RXN: | + | * DRUGBANK : DB04104 |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R03219 R03219] | + | * PUBCHEM: |
− | * UNIPROT:
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1673 1673] |
− | ** [http://www.uniprot.org/uniprot/P21195 P21195] | + | * HMDB : HMDB11600 |
− | ** [http://www.uniprot.org/uniprot/Q10576 Q10576]
| + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P16924 P16924] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00913 C00913] |
− | ** [http://www.uniprot.org/uniprot/P13674 P13674] | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P05307 P05307] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38635 38635] |
− | ** [http://www.uniprot.org/uniprot/P09102 P09102] | + | * METABOLIGHTS : MTBLC38635 |
− | ** [http://www.uniprot.org/uniprot/P07237 P07237] | + | {{#set: smiles=CN1(C2(=NC=NC(=C(N)N=C1)2))}} |
− | ** [http://www.uniprot.org/uniprot/Q922C8 Q922C8]
| + | {{#set: inchi key=InChIKey=FSASIHFSFGAIJM-UHFFFAOYSA-N}} |
− | ** [http://www.uniprot.org/uniprot/P04785 P04785]
| + | {{#set: common name=3-methyladenine}} |
− | ** [http://www.uniprot.org/uniprot/P54001 P54001] | + | {{#set: molecular weight=149.155 }} |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | {{#set: produced by=RXN0-5189}} |
− | {{#set: common name=prolyl_4-hydroxylase}}
| + | |
− | {{#set: common name=ORF}}
| + | |
− | {{#set: ec number=EC-1.14.11.2}}
| + | |
− | {{#set: gene associated=Tiso_gene_4246|Tiso_gene_17823|Tiso_gene_18933|Tiso_gene_16122|Tiso_gene_18235|Tiso_gene_292|Tiso_gene_15594|Tiso_gene_9035|Tiso_gene_18208|Tiso_gene_18145|Tiso_gene_15328|Tiso_gene_6296|Tiso_gene_3021|Tiso_gene_17593|Tiso_gene_2280|Tiso_gene_9165|Tiso_gene_9873|Tiso_gene_17919|Tiso_gene_9636|Tiso_gene_18689|Tiso_gene_16842|Tiso_gene_19638|Tiso_gene_9227|Tiso_gene_9455|Tiso_gene_1468|Tiso_gene_13008|Tiso_gene_2158|Tiso_gene_8652}} | + | |
− | {{#set: in pathway=}}
| + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |
− | {{#set: reconstruction source=esiliculosus}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}} | + | |