Difference between revisions of "5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Methyl-Adenines 3-Methyl-Adenines] == * smiles: ** CN1(C2(=NC=NC(=C(N)N=C1)2)) * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-4-alpha-D-Glucan 1-4-alpha-D-Glucan] == * common name: ** a 1,4-α-D-glucan * Synonym(s)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-4-alpha-D-Glucan 1-4-alpha-D-Glucan] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a 1,4-α-D-glucan |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[MALTODEXGLUCOSID-RXN]] | ||
| + | * [[RXN0-5184]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN0- | + | * [[MALTODEXGLUCOSID-RXN]] |
| + | * [[RXN0-5184]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a 1,4-α-D-glucan}} | |
| − | + | {{#set: consumed by=MALTODEXGLUCOSID-RXN|RXN0-5184}} | |
| − | + | {{#set: produced by=MALTODEXGLUCOSID-RXN|RXN0-5184}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: produced by=RXN0- | + | |
Revision as of 18:24, 18 March 2018
Contents
Metabolite 1-4-alpha-D-Glucan
- common name:
- a 1,4-α-D-glucan
- Synonym(s):
