Difference between revisions of "CHOLINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYURIDINE DEOXYURIDINE] == * smiles: ** C1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2)) * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_909 == * left end position: ** 11809 * transcription direction: ** POSITIVE * right end position: ** 13675 * centisome position: ** 42.6564...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_909 == |
− | * | + | * left end position: |
− | ** | + | ** 11809 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 13675 |
− | * | + | * centisome position: |
− | ** | + | ** 42.656406 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN-12459]] | |
− | * [[RXN- | + | ** in-silico_annotation |
− | == | + | ***ec-number |
− | + | == Pathways associated == | |
== External links == | == External links == | ||
− | + | {{#set: left end position=11809}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=13675}} | |
− | + | {{#set: centisome position=42.656406 }} | |
− | + | {{#set: reaction associated=RXN-12459}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 18:25, 18 March 2018
Gene Tiso_gene_909
- left end position:
- 11809
- transcription direction:
- POSITIVE
- right end position:
- 13675
- centisome position:
- 42.656406
- Synonym(s):
Reactions associated
- RXN-12459
- in-silico_annotation
- ec-number
- in-silico_annotation