Difference between revisions of "3-Hydroxy-Terminated-DNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] == * smiles: ** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6383 PWY-6383] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1762 TAX-1762]
+
** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
 +
* inchi key:
 +
** InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O
 
* common name:
 
* common name:
−
** mono-trans, poly-cis decaprenyl phosphate biosynthesis
+
** nicotine-glucuronide
 +
* molecular weight:
 +
** 339.367   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''2''' reactions found over '''5''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[GPPSYN-RXN]]
+
* [[RXN66-83]]
−
* [[IPPISOM-RXN]]
+
== Reaction(s) of unknown directionality ==
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=2.5.1.68-RXN 2.5.1.68-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11023 RXN-11023]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11027 RXN-11027]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-1762}}
+
* PUBCHEM:
−
{{#set: common name=mono-trans, poly-cis decaprenyl phosphate biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820524 91820524]
−
{{#set: reaction found=2}}
+
* HMDB : HMDB01272
−
{{#set: reaction not found=5}}
+
{{#set: smiles=C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}}
−
{{#set: completion rate=40.0}}
+
{{#set: inchi key=InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O}}
 +
{{#set: common name=nicotine-glucuronide}}
 +
{{#set: molecular weight=339.367    }}
 +
{{#set: produced by=RXN66-83}}

Revision as of 18:25, 18 March 2018

Metabolite CPD-2744

  • smiles:
    • C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
  • inchi key:
    • InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O
  • common name:
    • nicotine-glucuronide
  • molecular weight:
    • 339.367
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-Hydroxy-Terminated-DNAs&oldid=24270"