Difference between revisions of "Sulfhydryls"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_3991 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-esiliculosus == Pathways associated == ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-BETA-GLUCOSAMINYLAMINE N-ACETYL-BETA-GLUCOSAMINYLAMINE] == * smiles: ** CC(=O)NC1(C(N)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-BETA-GLUCOSAMINYLAMINE N-ACETYL-BETA-GLUCOSAMINYLAMINE] == |
+ | * smiles: | ||
+ | ** CC(=O)NC1(C(N)OC(CO)C(O)C(O)1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=MCGXOCXFFNKASF-FMDGEEDCSA-N | ||
+ | * common name: | ||
+ | ** N-acetyl-β-glucosaminylamine | ||
+ | * molecular weight: | ||
+ | ** 220.225 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[3.5.1.52-RXN]] | |
== External links == | == External links == | ||
− | {{#set: reaction associated= | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439454 439454] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.388560.html 388560] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15947 15947] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01239 C01239] | ||
+ | * HMDB : HMDB01104 | ||
+ | {{#set: smiles=CC(=O)NC1(C(N)OC(CO)C(O)C(O)1)}} | ||
+ | {{#set: inchi key=InChIKey=MCGXOCXFFNKASF-FMDGEEDCSA-N}} | ||
+ | {{#set: common name=N-acetyl-β-glucosaminylamine}} | ||
+ | {{#set: molecular weight=220.225 }} | ||
+ | {{#set: reversible reaction associated=3.5.1.52-RXN}} |
Revision as of 18:26, 18 March 2018
Contents
Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE
- smiles:
- CC(=O)NC1(C(N)OC(CO)C(O)C(O)1)
- inchi key:
- InChIKey=MCGXOCXFFNKASF-FMDGEEDCSA-N
- common name:
- N-acetyl-β-glucosaminylamine
- molecular weight:
- 220.225
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links