Difference between revisions of "PWY-6398"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) |
| + | * inchi key: | ||
| + | ** InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** N-acetyl-serotonin sulfate |
| + | * molecular weight: | ||
| + | ** 297.305 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** N-acetyl-5-hydroxytryptamine sulfate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | ||
| − | + | ||
| − | + | ||
* [[RXN-11059]] | * [[RXN-11059]] | ||
| − | + | == Reaction(s) of unknown directionality == | |
| − | == Reaction(s) | + | |
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514958 102514958] |
| − | {{#set: | + | * HMDB : HMDB60834 |
| − | {{#set: common name= | + | {{#set: smiles=CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: common name=N-acetyl-serotonin sulfate}} |
| − | {{#set: | + | {{#set: molecular weight=297.305 }} |
| + | {{#set: common name=N-acetyl-5-hydroxytryptamine sulfate}} | ||
| + | {{#set: produced by=RXN-11059}} | ||
Revision as of 18:26, 18 March 2018
Contents
Metabolite CPD-12017
- smiles:
- CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
- inchi key:
- InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
- common name:
- N-acetyl-serotonin sulfate
- molecular weight:
- 297.305
- Synonym(s):
- N-acetyl-5-hydroxytryptamine sulfate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB60834
"CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))" cannot be used as a page name in this wiki.
