Difference between revisions of "GLYOXDEG-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13694 CPD-13694] == * smiles: ** CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == |
* smiles: | * smiles: | ||
− | ** | + | ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N |
* common name: | * common name: | ||
− | ** | + | ** dehydroascorbate (bicyclic form) |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 192.125 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** dehydroascorbate monohydrate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12861]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12862]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659000 90659000] |
− | {{#set: smiles= | + | {{#set: smiles=C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N}} |
− | {{#set: common name= | + | {{#set: common name=dehydroascorbate (bicyclic form)}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=192.125 }} |
− | {{#set: common name= | + | {{#set: common name=dehydroascorbate monohydrate}} |
− | {{#set: | + | {{#set: consumed by=RXN-12861}} |
+ | {{#set: produced by=RXN-12862}} |
Revision as of 18:26, 18 March 2018
Contents
Metabolite CPD-13907
- smiles:
- C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))
- inchi key:
- InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N
- common name:
- dehydroascorbate (bicyclic form)
- molecular weight:
- 192.125
- Synonym(s):
- dehydroascorbate monohydrate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))" cannot be used as a page name in this wiki.