Difference between revisions of "RXN-14278"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...") |
(Created page with "Category:Gene == Gene Tiso_gene_18182 == * left end position: ** 200 * transcription direction: ** NEGATIVE * right end position: ** 3160 * centisome position: ** 6.261740...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_18182 == |
| − | * | + | * left end position: |
| − | ** | + | ** 200 |
| − | * | + | * transcription direction: |
| − | ** | + | ** NEGATIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 3160 |
| − | * | + | * centisome position: |
| − | ** | + | ** 6.2617407 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * [[TAU-PROTEIN-KINASE-RXN]] | |
| − | * [[ | + | ** in-silico_annotation |
| − | == | + | ***automated-name-match |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: left end position=200}} | |
| − | + | {{#set: transcription direction=NEGATIVE}} | |
| − | + | {{#set: right end position=3160}} | |
| − | {{#set: | + | {{#set: centisome position=6.2617407 }} |
| − | {{#set: | + | {{#set: reaction associated=TAU-PROTEIN-KINASE-RXN}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 18:26, 18 March 2018
Gene Tiso_gene_18182
- left end position:
- 200
- transcription direction:
- NEGATIVE
- right end position:
- 3160
- centisome position:
- 6.2617407
- Synonym(s):
Reactions associated
- TAU-PROTEIN-KINASE-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation
