Difference between revisions of "ExchangeSeed Pi"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15137 == * left end position: ** 3731 * transcription direction: ** POSITIVE * right end position: ** 4523 * centisome position: ** 71.6122...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-PHENYLPROPIONATE 3-PHENYLPROPIONATE] == * smiles: ** C(CCC1(=CC=CC=C1))([O-])=O * inchi key:...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-PHENYLPROPIONATE 3-PHENYLPROPIONATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(CCC1(=CC=CC=C1))([O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=XMIIGOLPHOKFCH-UHFFFAOYSA-M |
| − | * | + | * common name: |
| − | ** | + | ** 3-phenylpropanoate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 149.169 |
* Synonym(s): | * Synonym(s): | ||
| + | ** hydrocinnamate | ||
| + | ** 3-phenylpropionic acid | ||
| + | ** hydrocinnamic acid | ||
| + | ** HCA | ||
| + | ** phenylpropanoate | ||
| + | ** 3-phenylpropionate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-18229]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4740700 4740700] |
| − | {{#set: | + | * HMDB : HMDB00764 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05629 C05629] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.3927902.html 3927902] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=51057 51057] | ||
| + | * BIGG : pppn | ||
| + | {{#set: smiles=C(CCC1(=CC=CC=C1))([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=XMIIGOLPHOKFCH-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=3-phenylpropanoate}} | ||
| + | {{#set: molecular weight=149.169 }} | ||
| + | {{#set: common name=hydrocinnamate|3-phenylpropionic acid|hydrocinnamic acid|HCA|phenylpropanoate|3-phenylpropionate}} | ||
| + | {{#set: produced by=RXN-18229}} | ||
Revision as of 18:26, 18 March 2018
Contents
Metabolite 3-PHENYLPROPIONATE
- smiles:
- C(CCC1(=CC=CC=C1))([O-])=O
- inchi key:
- InChIKey=XMIIGOLPHOKFCH-UHFFFAOYSA-M
- common name:
- 3-phenylpropanoate
- molecular weight:
- 149.169
- Synonym(s):
- hydrocinnamate
- 3-phenylpropionic acid
- hydrocinnamic acid
- HCA
- phenylpropanoate
- 3-phenylpropionate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CCC1(=CC=CC=C1))([O-])=O" cannot be used as a page name in this wiki.
