Difference between revisions of "CPD-19042"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROXY-MAGNESIUM-PROTOPORP 13-HYDROXY-MAGNESIUM-PROTOPORP] == * smiles: ** C=CC2(C(C)=C4(C=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6578 PWY-6578] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROXY-MAGNESIUM-PROTOPORP 13-HYDROXY-MAGNESIUM-PROTOPORP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6578 PWY-6578] ==
−
* smiles:
+
* taxonomic range:
−
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** 131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester
+
** 8-amino-7-oxononanoate biosynthesis III
−
* molecular weight:
+
−
** 613.974   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 131-hydroxy-Mg-protoporphyrin IX 13-monomethyl ester
+
** 7-keto-8-aminopelargonate biosynthesis III
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-5283]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[7KAPSYN-RXN]]
−
* [[RXN-5282]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_3555]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=6-CARBOXYHEXANOATE--COA-LIGASE-RXN 6-CARBOXYHEXANOATE--COA-LIGASE-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658233 90658233]
+
{{#set: common name=8-amino-7-oxononanoate biosynthesis III}}
−
* HMDB : HMDB02379
+
{{#set: common name=7-keto-8-aminopelargonate biosynthesis III}}
−
* CHEBI:
+
{{#set: reaction found=1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60489 60489]
+
{{#set: total reaction=2}}
−
* LIGAND-CPD:
+
{{#set: completion rate=50.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11829 C11829]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8))))}}
+
−
{{#set: common name=131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester}}
+
−
{{#set: molecular weight=613.974    }}
+
−
{{#set: common name=131-hydroxy-Mg-protoporphyrin IX 13-monomethyl ester}}
+
−
{{#set: consumed by=RXN-5283}}
+
−
{{#set: produced by=RXN-5282}}
+

Revision as of 18:26, 18 March 2018

Pathway PWY-6578

  • taxonomic range:
  • common name:
    • 8-amino-7-oxononanoate biosynthesis III
  • Synonym(s):
    • 7-keto-8-aminopelargonate biosynthesis III

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-19042&oldid=24405"