Difference between revisions of "RXN-5467"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DHRT_2mbcoa DHRT_2mbcoa] == * direction: ** LEFT-TO-RIGHT * common name: ** dihydrolipoyllysine-res...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DHRT_2mbcoa DHRT_2mbcoa] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
 +
* inchi key:
 +
** InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L
 
* common name:
 
* common name:
−
** dihydrolipoyllysine-residue (2-methylpropanoyl)transferase, 2-Methylbutanoyl-CoA forming
+
** D-arabinofuranose 5-phosphate
 +
* molecular weight:
 +
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** D-arabinofuranose 5P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[KDO-8PSYNTH-RXN]]
−
** 1.0 [[CPD-941]][m] '''+''' 1.0 [[CO-A]][m] '''=>''' 1.0 [[DIHYDROLIPOAMIDE]][m] '''+''' 1.0 [[2-METHYL-BUTYRYL-COA]][m]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 S-(2-methylbutanoyl)-dihydrolipoamide[m] '''+''' 1.0 coenzyme A[m] '''=>''' 1.0 dihydrolipoamide[m] '''+''' 1.0 2-methylbutanoyl-CoA[m]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_11793]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=dihydrolipoyllysine-residue (2-methylpropanoyl)transferase, 2-Methylbutanoyl-CoA forming}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91825727 91825727]
−
{{#set: gene associated=Tiso_gene_11793}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85971 85971]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L}}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: common name=D-arabinofuranose 5-phosphate}}
 +
{{#set: molecular weight=228.095    }}
 +
{{#set: common name=D-arabinofuranose 5P}}
 +
{{#set: consumed by=KDO-8PSYNTH-RXN}}

Revision as of 18:26, 18 March 2018

Metabolite CPD-18118

  • smiles:
    • C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
  • inchi key:
    • InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L
  • common name:
    • D-arabinofuranose 5-phosphate
  • molecular weight:
    • 228.095
  • Synonym(s):
    • D-arabinofuranose 5P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-5467&oldid=24434"