Difference between revisions of "Tiso gene 5561"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Gene == Gene Tiso_gene_7477 == * left end position: ** 5488 * transcription direction: ** POSITIVE * right end position: ** 7069 * centisome position: ** 23.10445...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] ==
+
== Gene Tiso_gene_7477 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 5488
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** phytenoyl-CoA
+
** 7069
−
* molecular weight:
+
* centisome position:
−
** 1056.006    
+
** 23.10445    
 
* Synonym(s):
 
* Synonym(s):
−
** E-phytenoyl-CoA
 
−
** trans-phytenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-482]]
+
* [[ACYL-COA-HYDROLASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[RXN66-480]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
* [[LINOLEOYL-RXN]]
 +
** [[pantograph]]-[[athaliana]]
 +
* [[RXN-10708]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-13430]]
 +
** [[pantograph]]-[[athaliana]]
 +
* [[RXN-13435]]
 +
** [[pantograph]]-[[athaliana]]
 +
* [[RXN-13446]]
 +
** [[pantograph]]-[[athaliana]]
 +
* [[RXN-15013]]
 +
** [[pantograph]]-[[athaliana]]
 +
* [[RXN-16063]]
 +
** [[pantograph]]-[[athaliana]]
 +
* [[RXN-9624]]
 +
** [[pantograph]]-[[athaliana]]
 +
* [[RXN-9629]]
 +
** [[pantograph]]-[[athaliana]]
 +
* [[RXN-9666]]
 +
** [[pantograph]]-[[athaliana]]
 +
== Pathways associated ==
 +
* [[PWY-1121]]
 +
* [[PWY-321]]
 +
* [[PWY-5972]]
 +
* [[PWY-6733]]
 +
* [[PWY-5996]]
 +
* [[PWY-735]]
 +
* [[CENTBENZCOA-PWY]]
 +
* [[PWY-7401]]
 +
* [[PWY3O-355]]
 +
* [[PWY-6917]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5488}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657969 90657969]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: right end position=7069}}
−
{{#set: inchi key=InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J}}
+
{{#set: centisome position=23.10445   }}
−
{{#set: common name=phytenoyl-CoA}}
+
{{#set: reaction associated=ACYL-COA-HYDROLASE-RXN|LINOLEOYL-RXN|RXN-10708|RXN-13430|RXN-13435|RXN-13446|RXN-15013|RXN-16063|RXN-9624|RXN-9629|RXN-9666}}
−
{{#set: molecular weight=1056.006   }}
+
{{#set: pathway associated=PWY-1121|PWY-321|PWY-5972|PWY-6733|PWY-5996|PWY-735|CENTBENZCOA-PWY|PWY-7401|PWY3O-355|PWY-6917}}
−
{{#set: common name=E-phytenoyl-CoA|trans-phytenoyl-CoA}}
+
−
{{#set: consumed by=RXN66-482}}
+
−
{{#set: produced by=RXN66-480}}
+

Revision as of 18:27, 18 March 2018

Gene Tiso_gene_7477

  • left end position:
    • 5488
  • transcription direction:
    • POSITIVE
  • right end position:
    • 7069
  • centisome position:
    • 23.10445
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5561&oldid=24444"