Difference between revisions of "RXN-7711"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13334 RXN-13334] == * direction: ** LEFT-TO-RIGHT * common name: ** phospholipase_c_beta_4 ** 1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLENETETRAHYDROMETHANOPTERIN METHYLENETETRAHYDROMETHANOPTERIN] == * smiles: ** CC4([CH]3(C(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLENETETRAHYDROMETHANOPTERIN METHYLENETETRAHYDROMETHANOPTERIN] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC4([CH]3(C(C)N(C2(C=CC(CC(O)C(O)C(O)COC1(C(O)C(C(COP([O-])(=O)OC(C(=O)[O-])CCC(=O)[O-])O1)O))=CC=2))CN3C5(C(=O)NC(N)=NC(N4)=5))) |
| + | * inchi key: | ||
| + | ** InChIKey=GBMIGEWJAPFSQI-CAFBYHECSA-K | ||
* common name: | * common name: | ||
| − | ** | + | ** 5,10-methylene-tetrahydromethanopterin |
| − | + | * molecular weight: | |
| − | * | + | ** 785.677 |
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| + | ** N5,N10-methylene-5,6,7,8-tetrahydromethanopterin | ||
| + | ** 5,10-methylene-5,6,7,8-tetrahydromethanopterin | ||
| + | ** methylene-H4MPT | ||
| + | ** 5,10-methylene-H4MPT | ||
| + | ** N5,N10-methylenetetrahydromethanopterin | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-15635]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46931094 46931094] | |
| − | + | * CHEBI: | |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57818 57818] | |
| − | + | * LIGAND-CPD: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04377 C04377] | |
| − | {{#set: | + | * HMDB : HMDB60401 |
| − | {{#set: | + | {{#set: smiles=CC4([CH]3(C(C)N(C2(C=CC(CC(O)C(O)C(O)COC1(C(O)C(C(COP([O-])(=O)OC(C(=O)[O-])CCC(=O)[O-])O1)O))=CC=2))CN3C5(C(=O)NC(N)=NC(N4)=5)))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=GBMIGEWJAPFSQI-CAFBYHECSA-K}} |
| − | {{#set: | + | {{#set: common name=5,10-methylene-tetrahydromethanopterin}} |
| − | {{#set: | + | {{#set: molecular weight=785.677 }} |
| − | {{#set: | + | {{#set: common name=N5,N10-methylene-5,6,7,8-tetrahydromethanopterin|5,10-methylene-5,6,7,8-tetrahydromethanopterin|methylene-H4MPT|5,10-methylene-H4MPT|N5,N10-methylenetetrahydromethanopterin}} |
| + | {{#set: consumed by=RXN-15635}} | ||
Revision as of 18:27, 18 March 2018
Contents
Metabolite METHYLENETETRAHYDROMETHANOPTERIN
- smiles:
- CC4([CH]3(C(C)N(C2(C=CC(CC(O)C(O)C(O)COC1(C(O)C(C(COP([O-])(=O)OC(C(=O)[O-])CCC(=O)[O-])O1)O))=CC=2))CN3C5(C(=O)NC(N)=NC(N4)=5)))
- inchi key:
- InChIKey=GBMIGEWJAPFSQI-CAFBYHECSA-K
- common name:
- 5,10-methylene-tetrahydromethanopterin
- molecular weight:
- 785.677
- Synonym(s):
- N5,N10-methylene-5,6,7,8-tetrahydromethanopterin
- 5,10-methylene-5,6,7,8-tetrahydromethanopterin
- methylene-H4MPT
- 5,10-methylene-H4MPT
- N5,N10-methylenetetrahydromethanopterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC4([CH]3(C(C)N(C2(C=CC(CC(O)C(O)C(O)COC1(C(O)C(C(COP([O-])(=O)OC(C(=O)[O-])CCC(=O)[O-])O1)O))=CC=2))CN3C5(C(=O)NC(N)=NC(N4)=5)))" cannot be used as a page name in this wiki.
