Difference between revisions of "PWY-7579"

Revision as of 18:27, 18 March 2018

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alkylated-Bases Alkylated-Bases] ==
-* smiles:
-** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
-* inchi key:
-** InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L
 * common name:
-** betanidin quinone
+** an alkylated nucleobase
-* molecular weight:
-** 384.301
 * Synonym(s):
+** an alkylated nucleotide base
 == Reaction(s) known to consume the compound ==
 == Reaction(s) known to produce the compound ==
-* [[RXN-8635]]
+* [[3.2.2.21-RXN]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-* PUBCHEM:
+{{#set: common name=an alkylated nucleobase}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246300 25246300]
+{{#set: common name=an alkylated nucleotide base}}
-{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
+{{#set: produced by=3.2.2.21-RXN}}
-{{#set: inchi key=InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L}}
-{{#set: common name=betanidin quinone}}
-{{#set: molecular weight=384.301    }}
-{{#set: produced by=RXN-8635}}