Difference between revisions of "RXN-9600"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] == * smiles: ** C1(C=C(O)C=CC=1C(OC2(OC(CO)C(O)C(O)C(O)2))C#N) * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-27 CPDQT-27] == * smiles: ** CSCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=GRUGZHAOXOPASC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-27 CPDQT-27] == |
* smiles: | * smiles: | ||
− | ** | + | ** CSCCCCC(=O)C([O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M |
* common name: | * common name: | ||
− | ** | + | ** 6-(methylthio)-2-oxohexanoate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 175.222 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 6-(methylthio)-2-oxohexanoic acid |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-18209]] | ||
+ | * [[RXNQT-4165]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237195 44237195] |
− | * | + | * KNAPSACK : C00007648 |
− | + | {{#set: smiles=CSCCCCC(=O)C([O-])=O}} | |
− | + | {{#set: inchi key=InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M}} | |
− | + | {{#set: common name=6-(methylthio)-2-oxohexanoate}} | |
− | + | {{#set: molecular weight=175.222 }} | |
− | + | {{#set: common name=6-(methylthio)-2-oxohexanoic acid}} | |
− | + | {{#set: produced by=RXN-18209|RXNQT-4165}} | |
− | {{#set: smiles= | + | |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 18:27, 18 March 2018
Contents
Metabolite CPDQT-27
- smiles:
- CSCCCCC(=O)C([O-])=O
- inchi key:
- InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M
- common name:
- 6-(methylthio)-2-oxohexanoate
- molecular weight:
- 175.222
- Synonym(s):
- 6-(methylthio)-2-oxohexanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- KNAPSACK : C00007648
"CSCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.