Difference between revisions of "Tiso gene 4806"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14505 == * left end position: ** 1572 * transcription direction: ** POSITIVE * right end position: ** 3270 * centisome position: ** 28.0363...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ERYTHRO-4-HYDROXY-GLUTAMATE L-ERYTHRO-4-HYDROXY-GLUTAMATE] == * smiles: ** C([O-])(C(CC(O)C([...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ERYTHRO-4-HYDROXY-GLUTAMATE L-ERYTHRO-4-HYDROXY-GLUTAMATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C([O-])(C(CC(O)C([O-])=O)[N+])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HBDWQSHEVMSFGY-STHAYSLISA-M |
| − | * | + | * common name: |
| − | ** | + | ** erythro-4-hydroxy-L-glutamate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 162.122 |
* Synonym(s): | * Synonym(s): | ||
| + | ** (4S)-4-hydroxy-L-glutamic acid | ||
| + | ** (4S)-4-hydroxy-L-glutamate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[HYDROXYPYRROLINEDEH-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971086 6971086] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.5341963.html 5341963] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6331 6331] |
| + | * METABOLIGHTS : MTBLC6331 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05947 C05947] | ||
| + | {{#set: smiles=C([O-])(C(CC(O)C([O-])=O)[N+])=O}} | ||
| + | {{#set: inchi key=InChIKey=HBDWQSHEVMSFGY-STHAYSLISA-M}} | ||
| + | {{#set: common name=erythro-4-hydroxy-L-glutamate}} | ||
| + | {{#set: molecular weight=162.122 }} | ||
| + | {{#set: common name=(4S)-4-hydroxy-L-glutamic acid|(4S)-4-hydroxy-L-glutamate}} | ||
| + | {{#set: reversible reaction associated=HYDROXYPYRROLINEDEH-RXN}} | ||
Revision as of 18:28, 18 March 2018
Contents
Metabolite L-ERYTHRO-4-HYDROXY-GLUTAMATE
- smiles:
- C([O-])(C(CC(O)C([O-])=O)[N+])=O
- inchi key:
- InChIKey=HBDWQSHEVMSFGY-STHAYSLISA-M
- common name:
- erythro-4-hydroxy-L-glutamate
- molecular weight:
- 162.122
- Synonym(s):
- (4S)-4-hydroxy-L-glutamic acid
- (4S)-4-hydroxy-L-glutamate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(C(CC(O)C([O-])=O)[N+])=O" cannot be used as a page name in this wiki.
