Difference between revisions of "PWY-7197"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10821 RXN-10821] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] == * smiles: ** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10821 RXN-10821] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/2.3.1.192 EC-2.3.1.192]
+
** InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J
 +
* common name:
 +
** (S)-3-hydroxy-(5Z)-dodecenoyl-CoA
 +
* molecular weight:
 +
** 959.791   
 
* Synonym(s):
 
* Synonym(s):
 +
** (S)-3-hydroxy-12:1-Δ5-CoA
 +
** (S)-3-hydroxy-5-cis-dodecenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-17798]]
** 1 [[CPD-207]][c] '''+''' 1 [[GLY]][c] '''=>''' 1 [[CPD-11715]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CO-A]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-17797]]
** 1 phenylacetyl-CoA[c] '''+''' 1 glycine[c] '''=>''' 1 phenylacetylglycine[c] '''+''' 1 H+[c] '''+''' 1 coenzyme A[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_7195]]
+
** [[pantograph]]-[[athaliana]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
* [[PWY-6318]], L-phenylalanine degradation IV (mammalian, via side chain): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6318 PWY-6318]
+
** '''4''' reactions found over '''9''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[athaliana]]
+
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
{{#set: smiles=CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27850 27850]
+
{{#set: inchi key=InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J}}
* LIGAND-RXN:
+
{{#set: common name=(S)-3-hydroxy-(5Z)-dodecenoyl-CoA}}
** [http://www.genome.jp/dbget-bin/www_bget?R05841 R05841]
+
{{#set: molecular weight=959.791    }}
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=(S)-3-hydroxy-12:1-Δ5-CoA|(S)-3-hydroxy-5-cis-dodecenoyl-CoA}}
{{#set: ec number=EC-2.3.1.192}}
+
{{#set: consumed by=RXN-17798}}
{{#set: gene associated=Tiso_gene_7195}}
+
{{#set: produced by=RXN-17797}}
{{#set: in pathway=PWY-6318}}
+
{{#set: reconstruction category=orthology}}
+
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=athaliana|esiliculosus}}
+

Revision as of 18:28, 18 March 2018

Metabolite CPD-19151

  • smiles:
    • CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J
  • common name:
    • (S)-3-hydroxy-(5Z)-dodecenoyl-CoA
  • molecular weight:
    • 959.791
  • Synonym(s):
    • (S)-3-hydroxy-12:1-Δ5-CoA
    • (S)-3-hydroxy-5-cis-dodecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.