Difference between revisions of "RXN-11842"

Revision as of 19:28, 18 March 2018

"C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_15644 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] ==
+* smiles:
+** C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))
+* inchi key:
+** InChIKey=FOCUAJYUOXSNDS-UHFFFAOYSA-M
+* common name:
+** 5-hydroxytryptophol sulfate
+* molecular weight:
+** 256.253
 * Synonym(s):
+** 5-hydroxytryptophol sulphate
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[NO3t]]
+== Reaction(s) known to produce the compound ==
-** [[pantograph]]-[[creinhardtii]]
+* [[RXN-10782]]
-* [[TCV3]]
+== Reaction(s) of unknown directionality ==
-** [[pantograph]]-[[athaliana]]
-* [[TRANS-RXN-137]]
-** [[pantograph]]-[[creinhardtii]]
-** [[pantograph]]-[[creinhardtii]]
-== Pathways associated ==
 == External links  ==
-{{#set: reaction associated=NO3t|TCV3|TRANS-RXN-137}}
+* PUBCHEM:
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237265 44237265]
+{{#set: smiles=C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))}}
+{{#set: inchi key=InChIKey=FOCUAJYUOXSNDS-UHFFFAOYSA-M}}
+{{#set: common name=5-hydroxytryptophol sulfate}}
+{{#set: molecular weight=256.253    }}
+{{#set: common name=5-hydroxytryptophol sulphate}}
+{{#set: produced by=RXN-10782}}