Difference between revisions of "General-Protein-Substrates"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ALLANTOIN S-ALLANTOIN] == * smiles: ** C1(NC(N)=O)(NC(=O)NC(=O)1) * inchi key: ** InChIKey=PO...") |
(Created page with "Category:Gene == Gene Tiso_gene_3171 == * left end position: ** 5123 * transcription direction: ** POSITIVE * right end position: ** 7381 * centisome position: ** 29.55804...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3171 == |
− | * | + | * left end position: |
− | ** | + | ** 5123 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 7381 |
− | * | + | * centisome position: |
− | ** | + | ** 29.558043 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PEPTIDYLPROLYL-ISOMERASE-RXN]] |
− | + | ** in-silico_annotation | |
− | * | + | ***automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=5123}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=7381}} | |
− | + | {{#set: centisome position=29.558043 }} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 18:28, 18 March 2018
Gene Tiso_gene_3171
- left end position:
- 5123
- transcription direction:
- POSITIVE
- right end position:
- 7381
- centisome position:
- 29.558043
- Synonym(s):
Reactions associated
- PEPTIDYLPROLYL-ISOMERASE-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation