Difference between revisions of "Tiso gene 8531"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta5-lignoceroyl-ACPs cis-delta5-lignoceroyl-ACPs] == * common name: ** a cis-delta5-C24:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11411 CPD-11411] == * smiles: ** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta5-lignoceroyl-ACPs cis-delta5-lignoceroyl-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11411 CPD-11411] ==
 +
* smiles:
 +
** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3))
 +
* inchi key:
 +
** InChIKey=XZMJVZBEXSKSSM-KFYUBCHVSA-M
 
* common name:
 
* common name:
** a cis-delta5-C24:1-[acp]
+
** tetraiodothyroacetate ester glucuronide
 +
* molecular weight:
 +
** 922.95   
 
* Synonym(s):
 
* Synonym(s):
 +
** tetraiodothyroacetic acid ester glucuronide
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1G-306]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1G-171]]
+
* [[RXN-10617]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a cis-delta5-C24:1-[acp]}}
+
* PUBCHEM:
{{#set: consumed by=RXN1G-306}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657880 90657880]
{{#set: produced by=RXN1G-171}}
+
{{#set: smiles=C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3))}}
 +
{{#set: inchi key=InChIKey=XZMJVZBEXSKSSM-KFYUBCHVSA-M}}
 +
{{#set: common name=tetraiodothyroacetate ester glucuronide}}
 +
{{#set: molecular weight=922.95    }}
 +
{{#set: common name=tetraiodothyroacetic acid ester glucuronide}}
 +
{{#set: produced by=RXN-10617}}

Revision as of 18:29, 18 March 2018

Metabolite CPD-11411

  • smiles:
    • C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3))
  • inchi key:
    • InChIKey=XZMJVZBEXSKSSM-KFYUBCHVSA-M
  • common name:
    • tetraiodothyroacetate ester glucuronide
  • molecular weight:
    • 922.95
  • Synonym(s):
    • tetraiodothyroacetic acid ester glucuronide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3))" cannot be used as a page name in this wiki.