Difference between revisions of "BTUR2-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONO-1-4-LACTONE L-GULONO-1-4-LACTONE] == * smiles: ** C(C([CH]1(C(C(C(O1)=O)O)O))O)O * inc...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-218 TRANS-RXN-218] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula ==...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-218 TRANS-RXN-218] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 2 [[PROTON]][c] '''=>''' 2 [[PROTON]][e] |
| − | == | + | * With common name(s): |
| + | ** 2 H+[c] '''=>''' 2 H+[e] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:29, 18 March 2018
Contents
Reaction TRANS-RXN-218
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
